C12H14BrN3O2S2 — CID 63238661
4-amino-2-bromo-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 63238661) has the molecular formula C12H14BrN3O2S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is 4-amino-2-bromo-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-2-bromo-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63238661 |
| Molecular Formula | C12H14BrN3O2S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 4-amino-2-bromo-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1csc(CCNS(=O)(=O)c2ccc(N)cc2Br)n1 |
| InChI | InChI=1S/C12H14BrN3O2S2/c1-8-7-19-12(16-8)4-5-15-20(17,18)11-3-2-9(14)6-10(11)13/h2-3,6-7,15H,4-5,14H2,1H3 |
| InChIKey | AQZBYDRNMZJWKJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|