C12H15N3O2S2 — CID 61126624
4-amino-2-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide (PubChem CID 61126624) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 4-amino-2-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-2-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 61126624 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-amino-2-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1csc(CNS(=O)(=O)c2ccc(N)cc2C)n1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-8-5-10(13)3-4-11(8)19(16,17)14-6-12-15-9(2)7-18-12/h3-5,7,14H,6,13H2,1-2H3 |
| InChIKey | RQMOCVNXISOTKO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|