C15H20N4OS — CID 82993398
3-amino-N,N-dimethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzamide (PubChem CID 82993398) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzamide.
| Compound Name | 3-amino-N,N-dimethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 82993398 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-amino-N,N-dimethyl-4-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzamide |
| SMILES | Cc1csc(CCNc2ccc(C(=O)N(C)C)cc2N)n1 |
| InChI | InChI=1S/C15H20N4OS/c1-10-9-21-14(18-10)6-7-17-13-5-4-11(8-12(13)16)15(20)19(2)3/h4-5,8-9,17H,6-7,16H2,1-3H3 |
| InChIKey | GMEKUNYNTKLRKA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|