C11H15N5O3S — CID 106393237
4-amino-N,N-dimethyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide (PubChem CID 106393237) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide.
| Compound Name | 4-amino-N,N-dimethyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 106393237 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)c(NCc2ncon2)c1 |
| InChI | InChI=1S/C11H15N5O3S/c1-16(2)20(17,18)8-3-4-9(12)10(5-8)13-6-11-14-7-19-15-11/h3-5,7,13H,6,12H2,1-2H3 |
| InChIKey | VBOSNNTVPJJPQM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|