C14H26N4O2S — CID 82900124
4-amino-3-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide (PubChem CID 82900124) has the molecular formula C14H26N4O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 4-amino-3-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-3-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82900124 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-amino-3-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)CCNc1cc(S(=O)(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C14H26N4O2S/c1-5-18(6-2)10-9-16-14-11-12(7-8-13(14)15)21(19,20)17(3)4/h7-8,11,16H,5-6,9-10,15H2,1-4H3 |
| InChIKey | NCYDPONVEHSOSL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|