C14H25N3O2S — CID 43454463
2-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide (PubChem CID 43454463) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43454463 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)CCNc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H25N3O2S/c1-5-17(6-2)12-11-15-13-9-7-8-10-14(13)20(18,19)16(3)4/h7-10,15H,5-6,11-12H2,1-4H3 |
| InChIKey | SCPDJPUDVMIYQV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |