2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid

C12H13N3O3 — CID 114184042

IUPAC2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid
SMILESCc1cc(NCCc2ncon2)ccc1C(=O)O
InChIInChI=1S/C12H13N3O3/c1-8-6-9(2-3-10(8)12(16)17)13-5-4-11-14-7-18-15-11/h2-3,6-7,13H,4-5H2,1H3,(H,16,17)
InChIKeyJGHSSHVVYSGLNF-UHFFFAOYSA-N
MW247.25 g/mol
LogP1.73
Rot. Bonds5

About 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid

2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid (PubChem CID 114184042) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid.

Molecular Properties

Compound Name2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid
PubChem CID114184042
Molecular FormulaC12H13N3O3
Molecular Weight247.25 g/mol
Exact Mass247.10
IUPAC Name2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid
SMILESCc1cc(NCCc2ncon2)ccc1C(=O)O
InChIInChI=1S/C12H13N3O3/c1-8-6-9(2-3-10(8)12(16)17)13-5-4-11-14-7-18-15-11/h2-3,6-7,13H,4-5H2,1H3,(H,16,17)
InChIKeyJGHSSHVVYSGLNF-UHFFFAOYSA-N
XLogP1.73
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid?
The IUPAC name of 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid (CID 114184042) is 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid.
What is the SMILES notation for 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid?
The canonical SMILES for 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid is Cc1cc(NCCc2ncon2)ccc1C(=O)O.
What is the InChIKey of 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid?
The InChIKey is JGHSSHVVYSGLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c1-8-6-9(2-3-10(8)12(16)17)13-5-4-11-14-7-18-15-11/h2-3,6-7,13H,4-5H2,1H3,(H,16,17).
What are the key properties of 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid?
2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid has a molecular weight of 247.25 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid is sourced from PubChem (CID 114184042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).