C10H11N5O2 — CID 106407353
2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzamide (PubChem CID 106407353) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzamide.
| Compound Name | 2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 106407353 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzamide |
| SMILES | NC(=O)c1cccc(NCc2ncon2)c1N |
| InChI | InChI=1S/C10H11N5O2/c11-9-6(10(12)16)2-1-3-7(9)13-4-8-14-5-17-15-8/h1-3,5,13H,4,11H2,(H2,12,16) |
| InChIKey | MUJIVBHNEMTWEB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|