C9H11N5O3S — CID 106393454
2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide (PubChem CID 106393454) has the molecular formula C9H11N5O3S and a molecular weight of 269.29 g/mol. Its IUPAC name is 2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide.
| Compound Name | 2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 106393454 |
| Molecular Formula | C9H11N5O3S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-amino-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide |
| SMILES | Nc1c(NCc2ncon2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H11N5O3S/c10-9-6(12-4-8-13-5-17-14-8)2-1-3-7(9)18(11,15)16/h1-3,5,12H,4,10H2,(H2,11,15,16) |
| InChIKey | VMJJXDKXZKYLDH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|