C9H15N3O2S2 — CID 112674920
2-amino-3-(2-methylsulfanylethylamino)benzenesulfonamide (PubChem CID 112674920) has the molecular formula C9H15N3O2S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-amino-3-(2-methylsulfanylethylamino)benzenesulfonamide.
| Compound Name | 2-amino-3-(2-methylsulfanylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 112674920 |
| Molecular Formula | C9H15N3O2S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-amino-3-(2-methylsulfanylethylamino)benzenesulfonamide |
| SMILES | CSCCNc1cccc(S(N)(=O)=O)c1N |
| InChI | InChI=1S/C9H15N3O2S2/c1-15-6-5-12-7-3-2-4-8(9(7)10)16(11,13)14/h2-4,12H,5-6,10H2,1H3,(H2,11,13,14) |
| InChIKey | OEJPEWDOKZXSKQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|