C12H22N4O3S — CID 115992668
2-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenesulfonamide (PubChem CID 115992668) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenesulfonamide.
| Compound Name | 2-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 115992668 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-amino-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenesulfonamide |
| SMILES | COCCN(C)CCNc1cccc(S(N)(=O)=O)c1N |
| InChI | InChI=1S/C12H22N4O3S/c1-16(8-9-19-2)7-6-15-10-4-3-5-11(12(10)13)20(14,17)18/h3-5,15H,6-9,13H2,1-2H3,(H2,14,17,18) |
| InChIKey | OQPNFRAXNPYNOM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|