C13H21N3O3S — CID 115992752
2-amino-3-(2-cyclopentyloxyethylamino)benzenesulfonamide (PubChem CID 115992752) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-amino-3-(2-cyclopentyloxyethylamino)benzenesulfonamide.
| Compound Name | 2-amino-3-(2-cyclopentyloxyethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 115992752 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-amino-3-(2-cyclopentyloxyethylamino)benzenesulfonamide |
| SMILES | Nc1c(NCCOC2CCCC2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H21N3O3S/c14-13-11(6-3-7-12(13)20(15,17)18)16-8-9-19-10-4-1-2-5-10/h3,6-7,10,16H,1-2,4-5,8-9,14H2,(H2,15,17,18) |
| InChIKey | YSMUBOWWOCXEPW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|