C13H21N3O — CID 104540407
3-N-(2-cyclohexyloxyethyl)pyridine-2,3-diamine (PubChem CID 104540407) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-N-(2-cyclohexyloxyethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(2-cyclohexyloxyethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104540407 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3-N-(2-cyclohexyloxyethyl)pyridine-2,3-diamine |
| SMILES | Nc1ncccc1NCCOC1CCCCC1 |
| InChI | InChI=1S/C13H21N3O/c14-13-12(7-4-8-16-13)15-9-10-17-11-5-2-1-3-6-11/h4,7-8,11,15H,1-3,5-6,9-10H2,(H2,14,16) |
| InChIKey | MZKSJGOTRIMXJG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|