About 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine
3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine (PubChem CID 104540211) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine |
| PubChem CID | 104540211 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine |
| SMILES | COCCOCCNc1cccnc1N |
| InChI | InChI=1S/C10H17N3O2/c1-14-7-8-15-6-5-12-9-3-2-4-13-10(9)11/h2-4,12H,5-8H2,1H3,(H2,11,13) |
| InChIKey | XEOBLRPPXGMCOQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine?
The IUPAC name of 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine (CID 104540211) is 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine.
What is the SMILES notation for 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine?
The canonical SMILES for 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine is COCCOCCNc1cccnc1N.
What is the InChIKey of 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine?
The InChIKey is XEOBLRPPXGMCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-14-7-8-15-6-5-12-9-3-2-4-13-10(9)11/h2-4,12H,5-8H2,1H3,(H2,11,13).
What are the key properties of 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine?
3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine has a molecular weight of 211.26 g/mol, XLogP of 0.74, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[2-(2-methoxyethoxy)ethyl]pyridine-2,3-diamine is sourced from PubChem (CID 104540211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).