C10H17N3O2 — CID 106308989
2-[3-[(2-amino-3-pyridinyl)amino]propoxy]ethanol (PubChem CID 106308989) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[3-[(2-amino-3-pyridinyl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(2-amino-3-pyridinyl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106308989 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[3-[(2-amino-3-pyridinyl)amino]propoxy]ethanol |
| SMILES | Nc1ncccc1NCCCOCCO |
| InChI | InChI=1S/C10H17N3O2/c11-10-9(3-1-4-13-10)12-5-2-7-15-8-6-14/h1,3-4,12,14H,2,5-8H2,(H2,11,13) |
| InChIKey | KSSYQIUPRHDWGR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|