C11H17N3O — CID 106394504
3-N-(2-but-3-enoxyethyl)pyridine-2,3-diamine (PubChem CID 106394504) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-N-(2-but-3-enoxyethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(2-but-3-enoxyethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 106394504 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-N-(2-but-3-enoxyethyl)pyridine-2,3-diamine |
| SMILES | C=CCCOCCNc1cccnc1N |
| InChI | InChI=1S/C11H17N3O/c1-2-3-8-15-9-7-13-10-5-4-6-14-11(10)12/h2,4-6,13H,1,3,7-9H2,(H2,12,14) |
| InChIKey | PAMSNDFALGQZHT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|