C10H15N3S — CID 106426053
3-N-(2-prop-2-enylsulfanylethyl)pyridine-2,3-diamine (PubChem CID 106426053) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 3-N-(2-prop-2-enylsulfanylethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(2-prop-2-enylsulfanylethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 106426053 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-N-(2-prop-2-enylsulfanylethyl)pyridine-2,3-diamine |
| SMILES | C=CCSCCNc1cccnc1N |
| InChI | InChI=1S/C10H15N3S/c1-2-7-14-8-6-12-9-4-3-5-13-10(9)11/h2-5,12H,1,6-8H2,(H2,11,13) |
| InChIKey | NOERWLIRDQPEAZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|