C7H9F2N3 — CID 104540629
3-N-(2,2-difluoroethyl)pyridine-2,3-diamine (PubChem CID 104540629) has the molecular formula C7H9F2N3 and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-N-(2,2-difluoroethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(2,2-difluoroethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104540629 |
| Molecular Formula | C7H9F2N3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-N-(2,2-difluoroethyl)pyridine-2,3-diamine |
| SMILES | Nc1ncccc1NCC(F)F |
| InChI | InChI=1S/C7H9F2N3/c8-6(9)4-12-5-2-1-3-11-7(5)10/h1-3,6,12H,4H2,(H2,10,11) |
| InChIKey | MBBYETRNCNXORT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |