C10H17N3 — CID 104539778
3-N-(3-methylbutan-2-yl)pyridine-2,3-diamine (PubChem CID 104539778) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-N-(3-methylbutan-2-yl)pyridine-2,3-diamine.
| Compound Name | 3-N-(3-methylbutan-2-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104539778 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-N-(3-methylbutan-2-yl)pyridine-2,3-diamine |
| SMILES | CC(C)C(C)Nc1cccnc1N |
| InChI | InChI=1S/C10H17N3/c1-7(2)8(3)13-9-5-4-6-12-10(9)11/h4-8,13H,1-3H3,(H2,11,12) |
| InChIKey | HSKJNAQLXNTHJI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |