C13H23N3 — CID 106022702
3-N-octan-4-ylpyridine-2,3-diamine (PubChem CID 106022702) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 3-N-octan-4-ylpyridine-2,3-diamine.
| Compound Name | 3-N-octan-4-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 106022702 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 3-N-octan-4-ylpyridine-2,3-diamine |
| SMILES | CCCCC(CCC)Nc1cccnc1N |
| InChI | InChI=1S/C13H23N3/c1-3-5-8-11(7-4-2)16-12-9-6-10-15-13(12)14/h6,9-11,16H,3-5,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | VULHZZHEFTZOLD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |