About N-octan-4-ylaniline
N-octan-4-ylaniline (PubChem CID 12779854) has the molecular formula C14H23N
and a molecular weight of 205.35 g/mol. Its IUPAC name is N-octan-4-ylaniline.
Molecular Properties
| Compound Name | N-octan-4-ylaniline |
| PubChem CID | 12779854 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-octan-4-ylaniline |
| SMILES | CCCCC(CCC)Nc1ccccc1 |
| InChI | InChI=1S/C14H23N/c1-3-5-10-13(9-4-2)15-14-11-7-6-8-12-14/h6-8,11-13,15H,3-5,9-10H2,1-2H3 |
| InChIKey | WJQHZXNPBAHESK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-octan-4-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octan-4-ylaniline?
The IUPAC name of N-octan-4-ylaniline (CID 12779854) is N-octan-4-ylaniline.
What is the SMILES notation for N-octan-4-ylaniline?
The canonical SMILES for N-octan-4-ylaniline is CCCCC(CCC)Nc1ccccc1.
What is the InChIKey of N-octan-4-ylaniline?
The InChIKey is WJQHZXNPBAHESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-3-5-10-13(9-4-2)15-14-11-7-6-8-12-14/h6-8,11-13,15H,3-5,9-10H2,1-2H3.
What are the key properties of N-octan-4-ylaniline?
N-octan-4-ylaniline has a molecular weight of 205.35 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-octan-4-ylaniline is sourced from PubChem (CID 12779854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).