About (2S)-2-anilinooctan-1-ol
(2S)-2-anilinooctan-1-ol (PubChem CID 135056963) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is (2S)-2-anilinooctan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-anilinooctan-1-ol |
| PubChem CID | 135056963 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2S)-2-anilinooctan-1-ol |
| SMILES | CCCCCC[C@@H](CO)Nc1ccccc1 |
| InChI | InChI=1S/C14H23NO/c1-2-3-4-6-11-14(12-16)15-13-9-7-5-8-10-13/h5,7-10,14-16H,2-4,6,11-12H2,1H3/t14-/m0/s1 |
| InChIKey | OMKHZUASSOJOKL-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-anilinooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-anilinooctan-1-ol?
The IUPAC name of (2S)-2-anilinooctan-1-ol (CID 135056963) is (2S)-2-anilinooctan-1-ol.
What is the SMILES notation for (2S)-2-anilinooctan-1-ol?
The canonical SMILES for (2S)-2-anilinooctan-1-ol is CCCCCC[C@@H](CO)Nc1ccccc1.
What is the InChIKey of (2S)-2-anilinooctan-1-ol?
The InChIKey is OMKHZUASSOJOKL-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H23NO/c1-2-3-4-6-11-14(12-16)15-13-9-7-5-8-10-13/h5,7-10,14-16H,2-4,6,11-12H2,1H3/t14-/m0/s1.
What are the key properties of (2S)-2-anilinooctan-1-ol?
(2S)-2-anilinooctan-1-ol has a molecular weight of 221.34 g/mol, XLogP of 3.43, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-anilinooctan-1-ol is sourced from PubChem (CID 135056963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).