About 2-anilinoheptanamide
2-anilinoheptanamide (PubChem CID 61005049) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-anilinoheptanamide.
Molecular Properties
| Compound Name | 2-anilinoheptanamide |
| PubChem CID | 61005049 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-anilinoheptanamide |
| SMILES | CCCCCC(Nc1ccccc1)C(N)=O |
| InChI | InChI=1S/C13H20N2O/c1-2-3-5-10-12(13(14)16)15-11-8-6-4-7-9-11/h4,6-9,12,15H,2-3,5,10H2,1H3,(H2,14,16) |
| InChIKey | TVAVRTKNDXZQEJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-anilinoheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoheptanamide?
The IUPAC name of 2-anilinoheptanamide (CID 61005049) is 2-anilinoheptanamide.
What is the SMILES notation for 2-anilinoheptanamide?
The canonical SMILES for 2-anilinoheptanamide is CCCCCC(Nc1ccccc1)C(N)=O.
What is the InChIKey of 2-anilinoheptanamide?
The InChIKey is TVAVRTKNDXZQEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-2-3-5-10-12(13(14)16)15-11-8-6-4-7-9-11/h4,6-9,12,15H,2-3,5,10H2,1H3,(H2,14,16).
What are the key properties of 2-anilinoheptanamide?
2-anilinoheptanamide has a molecular weight of 220.32 g/mol, XLogP of 2.53, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoheptanamide is sourced from PubChem (CID 61005049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).