About N-tridecan-6-ylaniline
N-tridecan-6-ylaniline (PubChem CID 151143089) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is N-tridecan-6-ylaniline.
Molecular Properties
| Compound Name | N-tridecan-6-ylaniline |
| PubChem CID | 151143089 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-tridecan-6-ylaniline |
| SMILES | CCCCCCCC(CCCCC)Nc1ccccc1 |
| InChI | InChI=1S/C19H33N/c1-3-5-7-8-11-15-18(14-10-6-4-2)20-19-16-12-9-13-17-19/h9,12-13,16-18,20H,3-8,10-11,14-15H2,1-2H3 |
| InChIKey | MWPMLHLIPNVROO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tridecan-6-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tridecan-6-ylaniline?
The IUPAC name of N-tridecan-6-ylaniline (CID 151143089) is N-tridecan-6-ylaniline.
What is the SMILES notation for N-tridecan-6-ylaniline?
The canonical SMILES for N-tridecan-6-ylaniline is CCCCCCCC(CCCCC)Nc1ccccc1.
What is the InChIKey of N-tridecan-6-ylaniline?
The InChIKey is MWPMLHLIPNVROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N/c1-3-5-7-8-11-15-18(14-10-6-4-2)20-19-16-12-9-13-17-19/h9,12-13,16-18,20H,3-8,10-11,14-15H2,1-2H3.
What are the key properties of N-tridecan-6-ylaniline?
N-tridecan-6-ylaniline has a molecular weight of 275.48 g/mol, XLogP of 6.41, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tridecan-6-ylaniline is sourced from PubChem (CID 151143089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).