C14H23N — CID 10646032
N-[(2R,3R)-3-methylheptan-2-yl]aniline (PubChem CID 10646032) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is N-[(2R,3R)-3-methylheptan-2-yl]aniline.
| Compound Name | N-[(2R,3R)-3-methylheptan-2-yl]aniline |
|---|---|
| PubChem CID | 10646032 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-[(2R,3R)-3-methylheptan-2-yl]aniline |
| SMILES | CCCC[C@@H](C)[C@@H](C)Nc1ccccc1 |
| InChI | InChI=1S/C14H23N/c1-4-5-9-12(2)13(3)15-14-10-7-6-8-11-14/h6-8,10-13,15H,4-5,9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | HJTIGXNWXWRYNY-CHWSQXEVSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |