3-hydrazinylpyridin-2-amine;molecular hydrogen

C5H10N4 — CID 143942730

IUPAC3-hydrazinylpyridin-2-amine;molecular hydrogen
SMILESNNc1cccnc1N.[H][H]
InChIInChI=1S/C5H8N4.H2/c6-5-4(9-7)2-1-3-8-5;/h1-3,9H,7H2,(H2,6,8);1H
InChIKeyMIXFYGWAOFNZPQ-UHFFFAOYSA-N
MW126.16 g/mol
LogP0.20
Rot. Bonds1

About 3-hydrazinylpyridin-2-amine;molecular hydrogen

3-hydrazinylpyridin-2-amine;molecular hydrogen (PubChem CID 143942730) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 3-hydrazinylpyridin-2-amine;molecular hydrogen.

Molecular Properties

Compound Name3-hydrazinylpyridin-2-amine;molecular hydrogen
PubChem CID143942730
Molecular FormulaC5H10N4
Molecular Weight126.16 g/mol
Exact Mass126.09
IUPAC Name3-hydrazinylpyridin-2-amine;molecular hydrogen
SMILESNNc1cccnc1N.[H][H]
InChIInChI=1S/C5H8N4.H2/c6-5-4(9-7)2-1-3-8-5;/h1-3,9H,7H2,(H2,6,8);1H
InChIKeyMIXFYGWAOFNZPQ-UHFFFAOYSA-N
XLogP0.20
TPSA76.96 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.16
LogP ≤ 50.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-hydrazinylpyridin-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydrazinylpyridin-2-amine;molecular hydrogen?
The IUPAC name of 3-hydrazinylpyridin-2-amine;molecular hydrogen (CID 143942730) is 3-hydrazinylpyridin-2-amine;molecular hydrogen.
What is the SMILES notation for 3-hydrazinylpyridin-2-amine;molecular hydrogen?
The canonical SMILES for 3-hydrazinylpyridin-2-amine;molecular hydrogen is NNc1cccnc1N.[H][H].
What is the InChIKey of 3-hydrazinylpyridin-2-amine;molecular hydrogen?
The InChIKey is MIXFYGWAOFNZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4.H2/c6-5-4(9-7)2-1-3-8-5;/h1-3,9H,7H2,(H2,6,8);1H.
What are the key properties of 3-hydrazinylpyridin-2-amine;molecular hydrogen?
3-hydrazinylpyridin-2-amine;molecular hydrogen has a molecular weight of 126.16 g/mol, XLogP of 0.20, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylpyridin-2-amine;molecular hydrogen is sourced from PubChem (CID 143942730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).