C11H15N3 — CID 130791635
3-N-(3-bicyclo[3.1.0]hexanyl)pyridine-2,3-diamine (PubChem CID 130791635) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-N-(3-bicyclo[3.1.0]hexanyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(3-bicyclo[3.1.0]hexanyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 130791635 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-N-(3-bicyclo[3.1.0]hexanyl)pyridine-2,3-diamine |
| SMILES | Nc1ncccc1NC1CC2CC2C1 |
| InChI | InChI=1S/C11H15N3/c12-11-10(2-1-3-13-11)14-9-5-7-4-8(7)6-9/h1-3,7-9,14H,4-6H2,(H2,12,13) |
| InChIKey | RZFTXNZLEJHJJZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |