C13H21N3 — CID 104540565
3-N-(2,2-dimethylcyclohexyl)pyridine-2,3-diamine (PubChem CID 104540565) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-N-(2,2-dimethylcyclohexyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(2,2-dimethylcyclohexyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104540565 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-N-(2,2-dimethylcyclohexyl)pyridine-2,3-diamine |
| SMILES | CC1(C)CCCCC1Nc1cccnc1N |
| InChI | InChI=1S/C13H21N3/c1-13(2)8-4-3-7-11(13)16-10-6-5-9-15-12(10)14/h5-6,9,11,16H,3-4,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | LBBKFTWMEPPKCC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |