About 3-Pyridyl pinacidil
3-Pyridyl pinacidil (PubChem CID 43347) has the molecular formula C13H19N5
and a molecular weight of 245.32 g/mol. Its IUPAC name is 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-pyridin-3-ylguanidine.
Molecular Properties
| Compound Name | 3-Pyridyl pinacidil |
| PubChem CID | 43347 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-pyridin-3-ylguanidine |
| SMILES | CC(C(C)(C)C)N=C(NC#N)NC1=CN=CC=C1 |
| InChI | InChI=1S/C13H19N5/c1-10(13(2,3)4)17-12(16-9-14)18-11-6-5-7-15-8-11/h5-8,10H,1-4H3,(H2,16,17,18) |
| InChIKey | YJCUMRGFIIKHFP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | 333 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-Pyridyl pinacidil with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Pyridyl pinacidil?
The IUPAC name of 3-Pyridyl pinacidil (CID 43347) is 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-pyridin-3-ylguanidine.
What is the SMILES notation for 3-Pyridyl pinacidil?
The canonical SMILES for 3-Pyridyl pinacidil is CC(C(C)(C)C)N=C(NC#N)NC1=CN=CC=C1.
What is the InChIKey of 3-Pyridyl pinacidil?
The InChIKey is YJCUMRGFIIKHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5/c1-10(13(2,3)4)17-12(16-9-14)18-11-6-5-7-15-8-11/h5-8,10H,1-4H3,(H2,16,17,18).
What are the key properties of 3-Pyridyl pinacidil?
3-Pyridyl pinacidil has a molecular weight of 245.32 g/mol, XLogP of 2.70, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Pyridyl pinacidil is sourced from PubChem (CID 43347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).