C11H9BrFN3 — CID 107634583
3-N-(2-bromo-5-fluorophenyl)pyridine-2,3-diamine (PubChem CID 107634583) has the molecular formula C11H9BrFN3 and a molecular weight of 282.12 g/mol. Its IUPAC name is 3-N-(2-bromo-5-fluorophenyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(2-bromo-5-fluorophenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 107634583 |
| Molecular Formula | C11H9BrFN3 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 3-N-(2-bromo-5-fluorophenyl)pyridine-2,3-diamine |
| SMILES | Nc1ncccc1Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H9BrFN3/c12-8-4-3-7(13)6-10(8)16-9-2-1-5-15-11(9)14/h1-6,16H,(H2,14,15) |
| InChIKey | XVPDQLHYGXSRNV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |