C11H8BrF2N3 — CID 102852542
3-N-(5-bromo-2,4-difluorophenyl)pyridine-2,3-diamine (PubChem CID 102852542) has the molecular formula C11H8BrF2N3 and a molecular weight of 300.11 g/mol. Its IUPAC name is 3-N-(5-bromo-2,4-difluorophenyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(5-bromo-2,4-difluorophenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 102852542 |
| Molecular Formula | C11H8BrF2N3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 3-N-(5-bromo-2,4-difluorophenyl)pyridine-2,3-diamine |
| SMILES | Nc1ncccc1Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C11H8BrF2N3/c12-6-4-10(8(14)5-7(6)13)17-9-2-1-3-16-11(9)15/h1-5,17H,(H2,15,16) |
| InChIKey | KDCAEYPAHIKBNT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|