C11H6Br2F2N2 — CID 102854834
3-bromo-N-(5-bromo-2,4-difluorophenyl)pyridin-4-amine (PubChem CID 102854834) has the molecular formula C11H6Br2F2N2 and a molecular weight of 363.99 g/mol. Its IUPAC name is 3-bromo-N-(5-bromo-2,4-difluorophenyl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(5-bromo-2,4-difluorophenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 102854834 |
| Molecular Formula | C11H6Br2F2N2 |
| Molecular Weight | 363.99 g/mol |
| Exact Mass | 361.89 |
| IUPAC Name | 3-bromo-N-(5-bromo-2,4-difluorophenyl)pyridin-4-amine |
| SMILES | Fc1cc(F)c(Nc2ccncc2Br)cc1Br |
| InChI | InChI=1S/C11H6Br2F2N2/c12-6-3-11(9(15)4-8(6)14)17-10-1-2-16-5-7(10)13/h1-5H,(H,16,17) |
| InChIKey | JUJRPQOJQIKLBW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|