C11H7BrCl2N2 — CID 104777922
3-bromo-N-(3,5-dichlorophenyl)pyridin-4-amine (PubChem CID 104777922) has the molecular formula C11H7BrCl2N2 and a molecular weight of 318.00 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dichlorophenyl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(3,5-dichlorophenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 104777922 |
| Molecular Formula | C11H7BrCl2N2 |
| Molecular Weight | 318.00 g/mol |
| Exact Mass | 315.92 |
| IUPAC Name | 3-bromo-N-(3,5-dichlorophenyl)pyridin-4-amine |
| SMILES | Clc1cc(Cl)cc(Nc2ccncc2Br)c1 |
| InChI | InChI=1S/C11H7BrCl2N2/c12-10-6-15-2-1-11(10)16-9-4-7(13)3-8(14)5-9/h1-6H,(H,15,16) |
| InChIKey | XUJUWFWVBRSMAE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.00 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |