About ethane;2-hydrazinylaniline;molecular hydrogen
ethane;2-hydrazinylaniline;molecular hydrogen (PubChem CID 142165021) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is ethane;2-hydrazinylaniline;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-hydrazinylaniline;molecular hydrogen |
| PubChem CID | 142165021 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | ethane;2-hydrazinylaniline;molecular hydrogen |
| SMILES | CC.NNc1ccccc1N.[H][H] |
| InChI | InChI=1S/C6H9N3.C2H6.H2/c7-5-3-1-2-4-6(5)9-8;1-2;/h1-4,9H,7-8H2;1-2H3;1H |
| InChIKey | BZRBPMPJVXGXIH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-hydrazinylaniline;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-hydrazinylaniline;molecular hydrogen?
The IUPAC name of ethane;2-hydrazinylaniline;molecular hydrogen (CID 142165021) is ethane;2-hydrazinylaniline;molecular hydrogen.
What is the SMILES notation for ethane;2-hydrazinylaniline;molecular hydrogen?
The canonical SMILES for ethane;2-hydrazinylaniline;molecular hydrogen is CC.NNc1ccccc1N.[H][H].
What is the InChIKey of ethane;2-hydrazinylaniline;molecular hydrogen?
The InChIKey is BZRBPMPJVXGXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3.C2H6.H2/c7-5-3-1-2-4-6(5)9-8;1-2;/h1-4,9H,7-8H2;1-2H3;1H.
What are the key properties of ethane;2-hydrazinylaniline;molecular hydrogen?
ethane;2-hydrazinylaniline;molecular hydrogen has a molecular weight of 155.24 g/mol, XLogP of 1.83, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-hydrazinylaniline;molecular hydrogen is sourced from PubChem (CID 142165021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).