About N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen
N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen (PubChem CID 145298068) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen |
| PubChem CID | 145298068 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen |
| SMILES | C=CC(=O)Nc1ccccc1N.CC.[H][H] |
| InChI | InChI=1S/C9H10N2O.C2H6.H2/c1-2-9(12)11-8-6-4-3-5-7(8)10;1-2;/h2-6H,1,10H2,(H,11,12);1-2H3;1H |
| InChIKey | PGSPKAWDFRFUSK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen?
The IUPAC name of N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen (CID 145298068) is N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen.
What is the SMILES notation for N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen?
The canonical SMILES for N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen is C=CC(=O)Nc1ccccc1N.CC.[H][H].
What is the InChIKey of N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen?
The InChIKey is PGSPKAWDFRFUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.C2H6.H2/c1-2-9(12)11-8-6-4-3-5-7(8)10;1-2;/h2-6H,1,10H2,(H,11,12);1-2H3;1H.
What are the key properties of N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen?
N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen has a molecular weight of 194.28 g/mol, XLogP of 2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)prop-2-enamide;ethane;molecular hydrogen is sourced from PubChem (CID 145298068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).