C12H14N2 — CID 143976036
2-N-[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,2-diamine (PubChem CID 143976036) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-N-[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,2-diamine.
| Compound Name | 2-N-[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 143976036 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-N-[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,2-diamine |
| SMILES | C=C/C=C(\C=C)Nc1ccccc1N |
| InChI | InChI=1S/C12H14N2/c1-3-7-10(4-2)14-12-9-6-5-8-11(12)13/h3-9,14H,1-2,13H2/b10-7+ |
| InChIKey | JBZVOUXCRNRWMM-JXMROGBWSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|