C10H14N2 — CID 15062875
2-N-but-3-enylbenzene-1,2-diamine (PubChem CID 15062875) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-N-but-3-enylbenzene-1,2-diamine.
| Compound Name | 2-N-but-3-enylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 15062875 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-N-but-3-enylbenzene-1,2-diamine |
| SMILES | C=CCCNc1ccccc1N |
| InChI | InChI=1S/C10H14N2/c1-2-3-8-12-10-7-5-4-6-9(10)11/h2,4-7,12H,1,3,8,11H2 |
| InChIKey | FVNCZEAEEIXLTM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|