About 3-N-but-3-enylpyridine-3,4-diamine
3-N-but-3-enylpyridine-3,4-diamine (PubChem CID 130570864) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-N-but-3-enylpyridine-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-but-3-enylpyridine-3,4-diamine |
| PubChem CID | 130570864 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-N-but-3-enylpyridine-3,4-diamine |
| SMILES | C=CCCNc1cnccc1N |
| InChI | InChI=1S/C9H13N3/c1-2-3-5-12-9-7-11-6-4-8(9)10/h2,4,6-7,12H,1,3,5H2,(H2,10,11) |
| InChIKey | LNHIPPIALRTLRU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-N-but-3-enylpyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-but-3-enylpyridine-3,4-diamine?
The IUPAC name of 3-N-but-3-enylpyridine-3,4-diamine (CID 130570864) is 3-N-but-3-enylpyridine-3,4-diamine.
What is the SMILES notation for 3-N-but-3-enylpyridine-3,4-diamine?
The canonical SMILES for 3-N-but-3-enylpyridine-3,4-diamine is C=CCCNc1cnccc1N.
What is the InChIKey of 3-N-but-3-enylpyridine-3,4-diamine?
The InChIKey is LNHIPPIALRTLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-2-3-5-12-9-7-11-6-4-8(9)10/h2,4,6-7,12H,1,3,5H2,(H2,10,11).
What are the key properties of 3-N-but-3-enylpyridine-3,4-diamine?
3-N-but-3-enylpyridine-3,4-diamine has a molecular weight of 163.22 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-but-3-enylpyridine-3,4-diamine is sourced from PubChem (CID 130570864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).