C13H15N3 — CID 103001772
4-N-but-3-enylquinoline-4,7-diamine (PubChem CID 103001772) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-N-but-3-enylquinoline-4,7-diamine.
| Compound Name | 4-N-but-3-enylquinoline-4,7-diamine |
|---|---|
| PubChem CID | 103001772 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-N-but-3-enylquinoline-4,7-diamine |
| SMILES | C=CCCNc1ccnc2cc(N)ccc12 |
| InChI | InChI=1S/C13H15N3/c1-2-3-7-15-12-6-8-16-13-9-10(14)4-5-11(12)13/h2,4-6,8-9H,1,3,7,14H2,(H,15,16) |
| InChIKey | VNGRZEXVYVMZCR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|