C18H19N3 — CID 103001025
4-N-[2-(3-methylphenyl)ethyl]quinoline-4,7-diamine (PubChem CID 103001025) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-N-[2-(3-methylphenyl)ethyl]quinoline-4,7-diamine.
| Compound Name | 4-N-[2-(3-methylphenyl)ethyl]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103001025 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-N-[2-(3-methylphenyl)ethyl]quinoline-4,7-diamine |
| SMILES | Cc1cccc(CCNc2ccnc3cc(N)ccc23)c1 |
| InChI | InChI=1S/C18H19N3/c1-13-3-2-4-14(11-13)7-9-20-17-8-10-21-18-12-15(19)5-6-16(17)18/h2-6,8,10-12H,7,9,19H2,1H3,(H,20,21) |
| InChIKey | UJXCASVDUPMVGK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|