C29H28ClN5 — CID 58223366
N-[2-[3-amino-5-[2-[(7-chloroquinolin-4-yl)amino]ethyl]phenyl]ethyl]-7-methylquinolin-4-amine (PubChem CID 58223366) has the molecular formula C29H28ClN5 and a molecular weight of 482.03 g/mol. Its IUPAC name is N-[2-[3-amino-5-[2-[(7-chloroquinolin-4-yl)amino]ethyl]phenyl]ethyl]-7-methylquinolin-4-amine.
| Compound Name | N-[2-[3-amino-5-[2-[(7-chloroquinolin-4-yl)amino]ethyl]phenyl]ethyl]-7-methylquinolin-4-amine |
|---|---|
| PubChem CID | 58223366 |
| Molecular Formula | C29H28ClN5 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[2-[3-amino-5-[2-[(7-chloroquinolin-4-yl)amino]ethyl]phenyl]ethyl]-7-methylquinolin-4-amine |
| SMILES | Cc1ccc2c(NCCc3cc(N)cc(CCNc4ccnc5cc(Cl)ccc45)c3)ccnc2c1 |
| InChI | InChI=1S/C29H28ClN5/c1-19-2-4-24-26(8-12-34-28(24)14-19)32-10-6-20-15-21(17-23(31)16-20)7-11-33-27-9-13-35-29-18-22(30)3-5-25(27)29/h2-5,8-9,12-18H,6-7,10-11,31H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | HLYRTLABCFMWQQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|