C17H19ClN2 — CID 11587318
7-chloro-N-[2-(cyclohexen-1-yl)ethyl]quinolin-4-amine (PubChem CID 11587318) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 7-chloro-N-[2-(cyclohexen-1-yl)ethyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[2-(cyclohexen-1-yl)ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 11587318 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 7-chloro-N-[2-(cyclohexen-1-yl)ethyl]quinolin-4-amine |
| SMILES | Clc1ccc2c(NCCC3=CCCCC3)ccnc2c1 |
| InChI | InChI=1S/C17H19ClN2/c18-14-6-7-15-16(9-11-20-17(15)12-14)19-10-8-13-4-2-1-3-5-13/h4,6-7,9,11-12H,1-3,5,8,10H2,(H,19,20) |
| InChIKey | HBXXAERKNRLROJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|