C22H18Cl2N4 — CID 18933493
(E)-N,N'-bis(7-chloroquinolin-4-yl)but-2-ene-1,4-diamine (PubChem CID 18933493) has the molecular formula C22H18Cl2N4 and a molecular weight of 409.32 g/mol. Its IUPAC name is (E)-N,N'-bis(7-chloroquinolin-4-yl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-bis(7-chloroquinolin-4-yl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 18933493 |
| Molecular Formula | C22H18Cl2N4 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-N,N'-bis(7-chloroquinolin-4-yl)but-2-ene-1,4-diamine |
| SMILES | Clc1ccc2c(NC/C=C/CNc3ccnc4cc(Cl)ccc34)ccnc2c1 |
| InChI | InChI=1S/C22H18Cl2N4/c23-15-3-5-17-19(7-11-27-21(17)13-15)25-9-1-2-10-26-20-8-12-28-22-14-16(24)4-6-18(20)22/h1-8,11-14H,9-10H2,(H,25,27)(H,26,28)/b2-1+ |
| InChIKey | DXNMHDDCUZXSAB-OWOJBTEDSA-N |
| XLogP | 6.17 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|