About CID 10433026
CID 10433026 (PubChem CID 10433026) has the molecular formula C15H12ClN2
and a molecular weight of 255.73 g/mol.
Molecular Properties
| Compound Name | CID 10433026 |
| PubChem CID | 10433026 |
| Molecular Formula | C15H12ClN2 |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | — |
| SMILES | Clc1ccc2c(NC[C]3[CH][CH][CH][CH]3)ccnc2c1 |
| InChI | InChI=1S/C15H12ClN2/c16-12-5-6-13-14(7-8-17-15(13)9-12)18-10-11-3-1-2-4-11/h1-9H,10H2,(H,17,18) |
| InChIKey | ORMJOSSTVLQKEN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 10433026 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10433026?
The IUPAC name of CID 10433026 (CID 10433026) is not available.
What is the SMILES notation for CID 10433026?
The canonical SMILES for CID 10433026 is Clc1ccc2c(NC[C]3[CH][CH][CH][CH]3)ccnc2c1.
What is the InChIKey of CID 10433026?
The InChIKey is ORMJOSSTVLQKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN2/c16-12-5-6-13-14(7-8-17-15(13)9-12)18-10-11-3-1-2-4-11/h1-9H,10H2,(H,17,18).
What are the key properties of CID 10433026?
CID 10433026 has a molecular weight of 255.73 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10433026 is sourced from PubChem (CID 10433026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).