About CID 46237810
CID 46237810 (PubChem CID 46237810) has the molecular formula C30H34ClFeN3O3+2
and a molecular weight of 575.92 g/mol.
Molecular Properties
| Compound Name | CID 46237810 |
| PubChem CID | 46237810 |
| Molecular Formula | C30H34ClFeN3O3+2 |
| Molecular Weight | 575.92 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | — |
| SMILES | CC1(C)COC2(CCN(C[C]3[CH][CH][CH][CH]3)CC2)OO1.Clc1ccc2c(NC[C]3[CH][CH][CH][CH]3)ccnc2c1.[Fe+2] |
| InChI | InChI=1S/C15H12ClN2.C15H22NO3.Fe/c16-12-5-6-13-14(7-8-17-15(13)9-12)18-10-11-3-1-2-4-11;1-14(2)12-17-15(19-18-14)7-9-16(10-8-15)11-13-5-3-4-6-13;/h1-9H,10H2,(H,17,18);3-6H,7-12H2,1-2H3;/q;;+2 |
| InChIKey | NBOOJXJZZXMKQE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 46237810 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46237810?
The IUPAC name of CID 46237810 (CID 46237810) is not available.
What is the SMILES notation for CID 46237810?
The canonical SMILES for CID 46237810 is CC1(C)COC2(CCN(C[C]3[CH][CH][CH][CH]3)CC2)OO1.Clc1ccc2c(NC[C]3[CH][CH][CH][CH]3)ccnc2c1.[Fe+2].
What is the InChIKey of CID 46237810?
The InChIKey is NBOOJXJZZXMKQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN2.C15H22NO3.Fe/c16-12-5-6-13-14(7-8-17-15(13)9-12)18-10-11-3-1-2-4-11;1-14(2)12-17-15(19-18-14)7-9-16(10-8-15)11-13-5-3-4-6-13;/h1-9H,10H2,(H,17,18);3-6H,7-12H2,1-2H3;/q;;+2.
What are the key properties of CID 46237810?
CID 46237810 has a molecular weight of 575.92 g/mol, XLogP of 5.64, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46237810 is sourced from PubChem (CID 46237810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).