C30H34ClFeN3O3+2 — CID 46237810
CID 46237810 (PubChem CID 46237810) has the molecular formula C30H34ClFeN3O3+2 and a molecular weight of 575.92 g/mol.
| Compound Name | CID 46237810 |
|---|---|
| PubChem CID | 46237810 |
| Molecular Formula | C30H34ClFeN3O3+2 |
| Molecular Weight | 575.92 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | — |
| SMILES | CC1(C)COC2(CCN(C[C]3[CH][CH][CH][CH]3)CC2)OO1.Clc1ccc2c(NC[C]3[CH][CH][CH][CH]3)ccnc2c1.[Fe+2] |
| InChI | InChI=1S/C15H12ClN2.C15H22NO3.Fe/c16-12-5-6-13-14(7-8-17-15(13)9-12)18-10-11-3-1-2-4-11;1-14(2)12-17-15(19-18-14)7-9-16(10-8-15)11-13-5-3-4-6-13;/h1-9H,10H2,(H,17,18);3-6H,7-12H2,1-2H3;/q;;+2 |
| InChIKey | NBOOJXJZZXMKQE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|