C15H17ClN2O2 — CID 133459173
7-chloro-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinolin-4-amine (PubChem CID 133459173) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 7-chloro-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 133459173 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 7-chloro-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinolin-4-amine |
| SMILES | CC1(CCNc2ccnc3cc(Cl)ccc23)OCCO1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-15(19-8-9-20-15)5-7-18-13-4-6-17-14-10-11(16)2-3-12(13)14/h2-4,6,10H,5,7-9H2,1H3,(H,17,18) |
| InChIKey | TVBXRMHKMMKBOK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |