C20H17ClMnN3O3 — CID 66549609
CID 66549609 (PubChem CID 66549609) has the molecular formula C20H17ClMnN3O3 and a molecular weight of 437.77 g/mol.
| Compound Name | CID 66549609 |
|---|---|
| PubChem CID | 66549609 |
| Molecular Formula | C20H17ClMnN3O3 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | — |
| SMILES | Clc1ccc2c(NCCNC[C]3[CH][CH][CH][CH]3)ccnc2c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mn] |
| InChI | InChI=1S/C17H17ClN3.3CO.Mn/c18-14-5-6-15-16(7-8-20-17(15)11-14)21-10-9-19-12-13-3-1-2-4-13;3*1-2;/h1-8,11,19H,9-10,12H2,(H,20,21);;;; |
| InChIKey | KRLSZCWMYDHNRL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|