C20H17Cl2N5S — CID 118728629
N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine (PubChem CID 118728629) has the molecular formula C20H17Cl2N5S and a molecular weight of 430.36 g/mol. Its IUPAC name is N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine.
| Compound Name | N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 118728629 |
| Molecular Formula | C20H17Cl2N5S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]-N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
| SMILES | Clc1ccc2c(NCCNCc3ccc(-c4ccnc(Cl)n4)s3)ccnc2c1 |
| InChI | InChI=1S/C20H17Cl2N5S/c21-13-1-3-15-16(5-7-24-18(15)11-13)25-10-9-23-12-14-2-4-19(28-14)17-6-8-26-20(22)27-17/h1-8,11,23H,9-10,12H2,(H,24,25) |
| InChIKey | YXXSNSOWGQBGRG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|