C24H24ClN3OS — CID 118728615
N'-(7-chloroquinolin-4-yl)-N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]propane-1,3-diamine (PubChem CID 118728615) has the molecular formula C24H24ClN3OS and a molecular weight of 438.00 g/mol. Its IUPAC name is N'-(7-chloroquinolin-4-yl)-N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]propane-1,3-diamine.
| Compound Name | N'-(7-chloroquinolin-4-yl)-N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 118728615 |
| Molecular Formula | C24H24ClN3OS |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N'-(7-chloroquinolin-4-yl)-N-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]propane-1,3-diamine |
| SMILES | COc1ccc(-c2ccc(CNCCCNc3ccnc4cc(Cl)ccc34)s2)cc1 |
| InChI | InChI=1S/C24H24ClN3OS/c1-29-19-6-3-17(4-7-19)24-10-8-20(30-24)16-26-12-2-13-27-22-11-14-28-23-15-18(25)5-9-21(22)23/h3-11,14-15,26H,2,12-13,16H2,1H3,(H,27,28) |
| InChIKey | ANLQTLPKWIZBQG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|