C27H30ClN3O3 — CID 56594877
2-methoxy-6-[[3-[[7-(4-methoxyphenyl)quinolin-4-yl]amino]propylamino]methyl]phenol;hydrochloride (PubChem CID 56594877) has the molecular formula C27H30ClN3O3 and a molecular weight of 480.01 g/mol. Its IUPAC name is 2-methoxy-6-[[3-[[7-(4-methoxyphenyl)quinolin-4-yl]amino]propylamino]methyl]phenol;hydrochloride.
| Compound Name | 2-methoxy-6-[[3-[[7-(4-methoxyphenyl)quinolin-4-yl]amino]propylamino]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 56594877 |
| Molecular Formula | C27H30ClN3O3 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-methoxy-6-[[3-[[7-(4-methoxyphenyl)quinolin-4-yl]amino]propylamino]methyl]phenol;hydrochloride |
| SMILES | COc1ccc(-c2ccc3c(NCCCNCc4cccc(OC)c4O)ccnc3c2)cc1.Cl |
| InChI | InChI=1S/C27H29N3O3.ClH/c1-32-22-10-7-19(8-11-22)20-9-12-23-24(13-16-30-25(23)17-20)29-15-4-14-28-18-21-5-3-6-26(33-2)27(21)31;/h3,5-13,16-17,28,31H,4,14-15,18H2,1-2H3,(H,29,30);1H |
| InChIKey | RMTIQUSNLUFXTD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|